C19H18N6 — CID 148807468
N-[6-[(Z)-pent-2-en-3-yl]-7H-purin-2-yl]quinolin-6-amine (PubChem CID 148807468) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is N-[6-[(Z)-pent-2-en-3-yl]-7H-purin-2-yl]quinolin-6-amine.
| Compound Name | N-[6-[(Z)-pent-2-en-3-yl]-7H-purin-2-yl]quinolin-6-amine |
|---|---|
| PubChem CID | 148807468 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[6-[(Z)-pent-2-en-3-yl]-7H-purin-2-yl]quinolin-6-amine |
| SMILES | C/C=C(/CC)c1nc(Nc2ccc3ncccc3c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C19H18N6/c1-3-12(4-2)16-17-18(22-11-21-17)25-19(24-16)23-14-7-8-15-13(10-14)6-5-9-20-15/h3,5-11H,4H2,1-2H3,(H2,21,22,23,24,25)/b12-3- |
| InChIKey | OPGBNMNRVXZGHU-BASWHVEKSA-N |
| XLogP | 4.46 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |