C19H22FN7O — CID 71184832
(Z,2S,3S)-2-[[[2-(3-fluoroanilino)-7H-purin-6-yl]amino]methyl]-3-methylhex-4-enamide (PubChem CID 71184832) has the molecular formula C19H22FN7O and a molecular weight of 383.43 g/mol. Its IUPAC name is (Z,2S,3S)-2-[[[2-(3-fluoroanilino)-7H-purin-6-yl]amino]methyl]-3-methylhex-4-enamide.
| Compound Name | (Z,2S,3S)-2-[[[2-(3-fluoroanilino)-7H-purin-6-yl]amino]methyl]-3-methylhex-4-enamide |
|---|---|
| PubChem CID | 71184832 |
| Molecular Formula | C19H22FN7O |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (Z,2S,3S)-2-[[[2-(3-fluoroanilino)-7H-purin-6-yl]amino]methyl]-3-methylhex-4-enamide |
| SMILES | C/C=C\[C@H](C)[C@@H](CNc1nc(Nc2cccc(F)c2)nc2nc[nH]c12)C(N)=O |
| InChI | InChI=1S/C19H22FN7O/c1-3-5-11(2)14(16(21)28)9-22-17-15-18(24-10-23-15)27-19(26-17)25-13-7-4-6-12(20)8-13/h3-8,10-11,14H,9H2,1-2H3,(H2,21,28)(H3,22,23,24,25,26,27)/b5-3-/t11-,14+/m0/s1 |
| InChIKey | SWYRVLJYRLDHOJ-GXCJQXLXSA-N |
| XLogP | 2.96 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|