C20H18F3N7O2 — CID 23585432
3-[[2-[3-(trifluoromethoxy)anilino]-7H-purin-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 23585432) has the molecular formula C20H18F3N7O2 and a molecular weight of 445.41 g/mol. Its IUPAC name is 3-[[2-[3-(trifluoromethoxy)anilino]-7H-purin-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[2-[3-(trifluoromethoxy)anilino]-7H-purin-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 23585432 |
| Molecular Formula | C20H18F3N7O2 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-[[2-[3-(trifluoromethoxy)anilino]-7H-purin-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1C2C=CC(C2)C1Nc1nc(Nc2cccc(OC(F)(F)F)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C20H18F3N7O2/c21-20(22,23)32-12-3-1-2-11(7-12)27-19-29-17-15(25-8-26-17)18(30-19)28-14-10-5-4-9(6-10)13(14)16(24)31/h1-5,7-10,13-14H,6H2,(H2,24,31)(H3,25,26,27,28,29,30) |
| InChIKey | RFFXSLKAAQNKJB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|