C20H22N7O+ — CID 123416299
3-[[2-(3-methylanilino)-7H-purin-9-ium-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 123416299) has the molecular formula C20H22N7O+ and a molecular weight of 376.44 g/mol. Its IUPAC name is 3-[[2-(3-methylanilino)-7H-purin-9-ium-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[2-(3-methylanilino)-7H-purin-9-ium-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 123416299 |
| Molecular Formula | C20H22N7O+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-[[2-(3-methylanilino)-7H-purin-9-ium-6-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1cccc(Nc2nc(NC3C4C=CC(C4)C3C(N)=O)c3[nH]c[nH+]c3n2)c1 |
| InChI | InChI=1S/C20H21N7O/c1-10-3-2-4-13(7-10)24-20-26-18-16(22-9-23-18)19(27-20)25-15-12-6-5-11(8-12)14(15)17(21)28/h2-7,9,11-12,14-15H,8H2,1H3,(H2,21,28)(H3,22,23,24,25,26,27)/p+1 |
| InChIKey | QEZXAWNFJZKCCV-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 122.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|