C21H22N6O3S2 — CID 56602545
3-[[7-methyl-2-(4-sulfamoylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 56602545) has the molecular formula C21H22N6O3S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 3-[[7-methyl-2-(4-sulfamoylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[7-methyl-2-(4-sulfamoylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 56602545 |
| Molecular Formula | C21H22N6O3S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-[[7-methyl-2-(4-sulfamoylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1csc2c(NC3C4C=CC(C4)C3C(N)=O)nc(Nc3ccc(S(N)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C21H22N6O3S2/c1-10-9-31-18-16(10)26-21(24-13-4-6-14(7-5-13)32(23,29)30)27-20(18)25-17-12-3-2-11(8-12)15(17)19(22)28/h2-7,9,11-12,15,17H,8H2,1H3,(H2,22,28)(H2,23,29,30)(H2,24,25,26,27) |
| InChIKey | WLTKESGGWDMVAE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|