C20H21N7O3S — CID 59240693
3-[[2-(3-sulfamoylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 59240693) has the molecular formula C20H21N7O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 3-[[2-(3-sulfamoylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[2-(3-sulfamoylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 59240693 |
| Molecular Formula | C20H21N7O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-[[2-(3-sulfamoylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1C2C=CC(C2)C1Nc1nc(Nc2cccc(S(N)(=O)=O)c2)nc2[nH]ccc12 |
| InChI | InChI=1S/C20H21N7O3S/c21-17(28)15-10-4-5-11(8-10)16(15)25-19-14-6-7-23-18(14)26-20(27-19)24-12-2-1-3-13(9-12)31(22,29)30/h1-7,9-11,15-16H,8H2,(H2,21,28)(H2,22,29,30)(H3,23,24,25,26,27) |
| InChIKey | XQQPYIALLZYONT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 168.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|