C17H16N6O — CID 162659686
2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N,N-dimethylacetamide (PubChem CID 162659686) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 162659686 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N,N-dimethylacetamide |
| SMILES | C#Cc1nc(Nc2cccc(CC(=O)N(C)C)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C17H16N6O/c1-4-13-15-16(19-10-18-15)22-17(21-13)20-12-7-5-6-11(8-12)9-14(24)23(2)3/h1,5-8,10H,9H2,2-3H3,(H2,18,19,20,21,22) |
| InChIKey | LYPKXMSUWSSBLA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|