C31H33N7 — CID 141146919
2-N-(1-benzylpiperidin-4-yl)-6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine (PubChem CID 141146919) has the molecular formula C31H33N7 and a molecular weight of 503.65 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 141146919 |
| Molecular Formula | C31H33N7 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine |
| SMILES | c1ccc(CN2CCC(Nc3nc(NCC(c4ccccc4)c4ccccc4)c4[nH]cnc4n3)CC2)cc1 |
| InChI | InChI=1S/C31H33N7/c1-4-10-23(11-5-1)21-38-18-16-26(17-19-38)35-31-36-29(28-30(37-31)34-22-33-28)32-20-27(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,22,26-27H,16-21H2,(H3,32,33,34,35,36,37) |
| InChIKey | DKANPEYXTVSPIK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |