C22H29N7O — CID 117094465
[1-[6-[(1-benzylpiperidin-4-yl)amino]-7H-purin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 117094465) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is [1-[6-[(1-benzylpiperidin-4-yl)amino]-7H-purin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[6-[(1-benzylpiperidin-4-yl)amino]-7H-purin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 117094465 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | [1-[6-[(1-benzylpiperidin-4-yl)amino]-7H-purin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1nc(NC2CCN(Cc3ccccc3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C22H29N7O/c30-14-18-7-4-10-29(18)22-26-20-19(23-15-24-20)21(27-22)25-17-8-11-28(12-9-17)13-16-5-2-1-3-6-16/h1-3,5-6,15,17-18,30H,4,7-14H2,(H2,23,24,25,26,27) |
| InChIKey | UQYHDHMCMRHGJV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |