C18H22N6O — CID 10806944
[1-[6-(benzylamino)-9-methylpurin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 10806944) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is [1-[6-(benzylamino)-9-methylpurin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[6-(benzylamino)-9-methylpurin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 10806944 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [1-[6-(benzylamino)-9-methylpurin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | Cn1cnc2c(NCc3ccccc3)nc(N3CCCC3CO)nc21 |
| InChI | InChI=1S/C18H22N6O/c1-23-12-20-15-16(19-10-13-6-3-2-4-7-13)21-18(22-17(15)23)24-9-5-8-14(24)11-25/h2-4,6-7,12,14,25H,5,8-11H2,1H3,(H,19,21,22) |
| InChIKey | SIQHHNCOOGVEDS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |