C17H21N7O4 — CID 85153305
3-[[[5-[2-(hydroxymethyl)pyrrolidin-1-yl]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol (PubChem CID 85153305) has the molecular formula C17H21N7O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 3-[[[5-[2-(hydroxymethyl)pyrrolidin-1-yl]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol.
| Compound Name | 3-[[[5-[2-(hydroxymethyl)pyrrolidin-1-yl]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 85153305 |
| Molecular Formula | C17H21N7O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[[[5-[2-(hydroxymethyl)pyrrolidin-1-yl]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
| SMILES | COc1ccc(CNc2nc(N3CCCC3CO)nc3n[nH]nc23)c(O)c1O |
| InChI | InChI=1S/C17H21N7O4/c1-28-11-5-4-9(13(26)14(11)27)7-18-15-12-16(22-23-21-12)20-17(19-15)24-6-2-3-10(24)8-25/h4-5,10,25-27H,2-3,6-8H2,1H3,(H2,18,19,20,21,22,23) |
| InChIKey | LXMVCWBREHLTTJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|