C27H39N7O — CID 177372356
2-[4-[1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]piperidin-4-yl]piperidin-1-yl]ethanol (PubChem CID 177372356) has the molecular formula C27H39N7O and a molecular weight of 477.66 g/mol. Its IUPAC name is 2-[4-[1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]piperidin-4-yl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]piperidin-4-yl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 177372356 |
| Molecular Formula | C27H39N7O |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 2-[4-[1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]piperidin-4-yl]piperidin-1-yl]ethanol |
| SMILES | CC(C)n1cnc2c(NCc3ccccc3)nc(N3CCC(C4CCN(CCO)CC4)CC3)nc21 |
| InChI | InChI=1S/C27H39N7O/c1-20(2)34-19-29-24-25(28-18-21-6-4-3-5-7-21)30-27(31-26(24)34)33-14-10-23(11-15-33)22-8-12-32(13-9-22)16-17-35/h3-7,19-20,22-23,35H,8-18H2,1-2H3,(H,28,30,31) |
| InChIKey | ABDPBSXQLBJPTL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |