C26H31N7 — CID 174206898
2-(3-methylpiperazin-1-yl)-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurin-6-amine (PubChem CID 174206898) has the molecular formula C26H31N7 and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-(3-methylpiperazin-1-yl)-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-(3-methylpiperazin-1-yl)-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 174206898 |
| Molecular Formula | C26H31N7 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 2-(3-methylpiperazin-1-yl)-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurin-6-amine |
| SMILES | CC1CN(c2nc(NCc3ccc(-c4ccccc4)cc3)c3ncn(C(C)C)c3n2)CCN1 |
| InChI | InChI=1S/C26H31N7/c1-18(2)33-17-29-23-24(30-26(31-25(23)33)32-14-13-27-19(3)16-32)28-15-20-9-11-22(12-10-20)21-7-5-4-6-8-21/h4-12,17-19,27H,13-16H2,1-3H3,(H,28,30,31) |
| InChIKey | PJJVFMLFQRVBAR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |