C28H42N8 — CID 142220807
2-N-(3-aminopropyl)-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine;ethanamine;ethane (PubChem CID 142220807) has the molecular formula C28H42N8 and a molecular weight of 490.70 g/mol. Its IUPAC name is 2-N-(3-aminopropyl)-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine;ethanamine;ethane.
| Compound Name | 2-N-(3-aminopropyl)-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine;ethanamine;ethane |
|---|---|
| PubChem CID | 142220807 |
| Molecular Formula | C28H42N8 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | 2-N-(3-aminopropyl)-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine;ethanamine;ethane |
| SMILES | CC.CC(C)n1cnc2c(NCc3ccc(-c4ccccc4)cc3)nc(NCCCN)nc21.CCN |
| InChI | InChI=1S/C24H29N7.C2H7N.C2H6/c1-17(2)31-16-28-21-22(29-24(30-23(21)31)26-14-6-13-25)27-15-18-9-11-20(12-10-18)19-7-4-3-5-8-19;1-2-3;1-2/h3-5,7-12,16-17H,6,13-15,25H2,1-2H3,(H2,26,27,29,30);2-3H2,1H3;1-2H3 |
| InChIKey | IJQWPCPCDVGFHP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|