C21H34N6OS — CID 164926363
2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]-3-sulfanylpropan-1-ol;ethane;methane (PubChem CID 164926363) has the molecular formula C21H34N6OS and a molecular weight of 418.61 g/mol. Its IUPAC name is 2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]-3-sulfanylpropan-1-ol;ethane;methane.
| Compound Name | 2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]-3-sulfanylpropan-1-ol;ethane;methane |
|---|---|
| PubChem CID | 164926363 |
| Molecular Formula | C21H34N6OS |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]-3-sulfanylpropan-1-ol;ethane;methane |
| SMILES | C.CC.CC(C)n1cnc2c(NCc3ccccc3)nc(NC(CO)CS)nc21 |
| InChI | InChI=1S/C18H24N6OS.C2H6.CH4/c1-12(2)24-11-20-15-16(19-8-13-6-4-3-5-7-13)22-18(23-17(15)24)21-14(9-25)10-26;1-2;/h3-7,11-12,14,25-26H,8-10H2,1-2H3,(H2,19,21,22,23);1-2H3;1H4 |
| InChIKey | ADZNRCWOWSKWJM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|