C19H26N6O3 — CID 10200164
4-[[[2-(1-hydroxybutan-2-ylamino)-9-propan-2-ylpurin-6-yl]amino]methyl]benzene-1,2-diol (PubChem CID 10200164) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[[[2-(1-hydroxybutan-2-ylamino)-9-propan-2-ylpurin-6-yl]amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[2-(1-hydroxybutan-2-ylamino)-9-propan-2-ylpurin-6-yl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 10200164 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[[[2-(1-hydroxybutan-2-ylamino)-9-propan-2-ylpurin-6-yl]amino]methyl]benzene-1,2-diol |
| SMILES | CCC(CO)Nc1nc(NCc2ccc(O)c(O)c2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C19H26N6O3/c1-4-13(9-26)22-19-23-17(16-18(24-19)25(10-21-16)11(2)3)20-8-12-5-6-14(27)15(28)7-12/h5-7,10-11,13,26-28H,4,8-9H2,1-3H3,(H2,20,22,23,24) |
| InChIKey | DEZJPTPBNXJPAP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|