C16H21N7O — CID 78073451
2-[[9-methyl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]butan-1-ol (PubChem CID 78073451) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[[9-methyl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]butan-1-ol.
| Compound Name | 2-[[9-methyl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 78073451 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-[[9-methyl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(NCc2cccnc2)c2ncn(C)c2n1 |
| InChI | InChI=1S/C16H21N7O/c1-3-12(9-24)20-16-21-14(13-15(22-16)23(2)10-19-13)18-8-11-5-4-6-17-7-11/h4-7,10,12,24H,3,8-9H2,1-2H3,(H2,18,20,21,22) |
| InChIKey | OAEIXFAHSCLGRA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |