C23H26N6O — CID 78076011
2-[[6-(benzhydrylamino)-9-methylpurin-2-yl]amino]butan-1-ol (PubChem CID 78076011) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[[6-(benzhydrylamino)-9-methylpurin-2-yl]amino]butan-1-ol.
| Compound Name | 2-[[6-(benzhydrylamino)-9-methylpurin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 78076011 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[[6-(benzhydrylamino)-9-methylpurin-2-yl]amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(NC(c2ccccc2)c2ccccc2)c2ncn(C)c2n1 |
| InChI | InChI=1S/C23H26N6O/c1-3-18(14-30)25-23-27-21(20-22(28-23)29(2)15-24-20)26-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15,18-19,30H,3,14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | RREBYOHOPJKCPN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |