C35H39N7O4 — CID 11498202
N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 11498202) has the molecular formula C35H39N7O4 and a molecular weight of 621.74 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 11498202 |
| Molecular Formula | C35H39N7O4 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NC(c4ccccc4)c4ccccc4)nc(N[C@H](CO)Cc4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H39N7O4/c1-2-28(44)38-26-19-27(32(46)31(26)45)42-21-36-30-33(39-29(23-14-8-4-9-15-23)24-16-10-5-11-17-24)40-35(41-34(30)42)37-25(20-43)18-22-12-6-3-7-13-22/h3-17,21,25-27,29,31-32,43,45-46H,2,18-20H2,1H3,(H,38,44)(H2,37,39,40,41)/t25-,26-,27+,31+,32-/m0/s1 |
| InChIKey | FYCJSFJDIFBBTO-ZAKMCFTLSA-N |
| XLogP | 3.60 |
| TPSA | 157.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |