C21H25ClN6O5 — CID 86632435
N-[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide (PubChem CID 86632435) has the molecular formula C21H25ClN6O5 and a molecular weight of 476.92 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 86632435 |
| Molecular Formula | C21H25ClN6O5 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)N[C@H]1C[C@@H](n2cnc3c(N[C@H](CO)Cc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H25ClN6O5/c22-21-26-19(24-12(8-29)6-11-4-2-1-3-5-11)16-20(27-21)28(10-23-16)14-7-13(17(32)18(14)33)25-15(31)9-30/h1-5,10,12-14,17-18,29-30,32-33H,6-9H2,(H,25,31)(H,24,26,27)/t12-,13-,14+,17+,18-/m0/s1 |
| InChIKey | MNPCJNTWLYJYNG-MIMASFHYSA-N |
| XLogP | -0.36 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |