C24H26ClF3N6O5 — CID 87240109
[(1S,2R,3S,5R)-5-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 87240109) has the molecular formula C24H26ClF3N6O5 and a molecular weight of 570.96 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2R,3S,5R)-5-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87240109 |
| Molecular Formula | C24H26ClF3N6O5 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [(1S,2R,3S,5R)-5-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(N[C@H](CO)Cc4ccccc4)nc(Cl)nc32)[C@H](OC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C24H26ClF3N6O5/c1-2-16(36)31-14-9-15(19(18(14)37)39-22(38)24(26,27)28)34-11-29-17-20(32-23(25)33-21(17)34)30-13(10-35)8-12-6-4-3-5-7-12/h3-7,11,13-15,18-19,35,37H,2,8-10H2,1H3,(H,31,36)(H,30,32,33)/t13-,14-,15+,18+,19-/m0/s1 |
| InChIKey | YBNHDWHEGOAIPL-JCEKIRTPSA-N |
| XLogP | 2.17 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |