C24H31N7O6 — CID 59418823
9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-[(2-hydroxyacetyl)amino]cyclopentyl]-N-ethyl-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purine-2-carboxamide (PubChem CID 59418823) has the molecular formula C24H31N7O6 and a molecular weight of 513.56 g/mol. Its IUPAC name is 9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-[(2-hydroxyacetyl)amino]cyclopentyl]-N-ethyl-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purine-2-carboxamide.
| Compound Name | 9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-[(2-hydroxyacetyl)amino]cyclopentyl]-N-ethyl-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purine-2-carboxamide |
|---|---|
| PubChem CID | 59418823 |
| Molecular Formula | C24H31N7O6 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-[(2-hydroxyacetyl)amino]cyclopentyl]-N-ethyl-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purine-2-carboxamide |
| SMILES | CCNC(=O)c1nc(N[C@H](CO)Cc2ccccc2)c2ncn([C@@H]3C[C@H](NC(=O)CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H31N7O6/c1-2-25-24(37)22-29-21(27-14(10-32)8-13-6-4-3-5-7-13)18-23(30-22)31(12-26-18)16-9-15(19(35)20(16)36)28-17(34)11-33/h3-7,12,14-16,19-20,32-33,35-36H,2,8-11H2,1H3,(H,25,37)(H,28,34)(H,27,29,30)/t14-,15-,16+,19+,20-/m0/s1 |
| InChIKey | KAOHBBUWIUORHB-GPEJODLCSA-N |
| XLogP | -1.26 |
| TPSA | 194.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |