C39H45N11O5 — CID 11614692
9-[(1R,2S,3R,4S)-4-acetamido-2,3-dihydroxycyclopentyl]-6-(benzhydrylamino)-N-[2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethyl]purine-2-carboxamide (PubChem CID 11614692) has the molecular formula C39H45N11O5 and a molecular weight of 747.86 g/mol. Its IUPAC name is 9-[(1R,2S,3R,4S)-4-acetamido-2,3-dihydroxycyclopentyl]-6-(benzhydrylamino)-N-[2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethyl]purine-2-carboxamide.
| Compound Name | 9-[(1R,2S,3R,4S)-4-acetamido-2,3-dihydroxycyclopentyl]-6-(benzhydrylamino)-N-[2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethyl]purine-2-carboxamide |
|---|---|
| PubChem CID | 11614692 |
| Molecular Formula | C39H45N11O5 |
| Molecular Weight | 747.86 g/mol |
| Exact Mass | 747.36 |
| IUPAC Name | 9-[(1R,2S,3R,4S)-4-acetamido-2,3-dihydroxycyclopentyl]-6-(benzhydrylamino)-N-[2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethyl]purine-2-carboxamide |
| SMILES | CC(=O)N[C@H]1C[C@@H](n2cnc3c(NC(c4ccccc4)c4ccccc4)nc(C(=O)NCCNC(=O)NC4CCN(c5ccccn5)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C39H45N11O5/c1-24(51)44-28-22-29(34(53)33(28)52)50-23-43-32-35(46-31(25-10-4-2-5-11-25)26-12-6-3-7-13-26)47-36(48-37(32)50)38(54)41-18-19-42-39(55)45-27-15-20-49(21-16-27)30-14-8-9-17-40-30/h2-14,17,23,27-29,31,33-34,52-53H,15-16,18-22H2,1H3,(H,41,54)(H,44,51)(H2,42,45,55)(H,46,47,48)/t28-,29+,33+,34-/m0/s1 |
| InChIKey | JICLUNSSIZDDBT-MYYPXIOMSA-N |
| XLogP | 2.29 |
| TPSA | 211.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|