C14H21N5O3 — CID 69019671
2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethylcarbamic acid (PubChem CID 69019671) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethylcarbamic acid.
| Compound Name | 2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 69019671 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C14H21N5O3/c20-13(16-7-8-17-14(21)22)18-11-4-9-19(10-5-11)12-3-1-2-6-15-12/h1-3,6,11,17H,4-5,7-10H2,(H,21,22)(H2,16,18,20) |
| InChIKey | TWXSGQFWTCBBTP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|