C22H28N4O2 — CID 167813911
1-[[(2S,4R)-4-phenyloxolan-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 167813911) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[[(2S,4R)-4-phenyloxolan-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[[(2S,4R)-4-phenyloxolan-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 167813911 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[[(2S,4R)-4-phenyloxolan-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(NC[C@@H]1C[C@H](c2ccccc2)CO1)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H28N4O2/c27-22(24-15-20-14-18(16-28-20)17-6-2-1-3-7-17)25-19-9-12-26(13-10-19)21-8-4-5-11-23-21/h1-8,11,18-20H,9-10,12-16H2,(H2,24,25,27)/t18-,20-/m0/s1 |
| InChIKey | SGKXDRRVPBPSEV-ICSRJNTNSA-N |
| XLogP | 2.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |