C17H24N4O2 — CID 111630604
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 111630604) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 111630604 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(NC1CCN(c2ccccn2)CC1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C17H24N4O2/c22-12-13-4-5-15(11-13)20-17(23)19-14-6-9-21(10-7-14)16-3-1-2-8-18-16/h1-5,8,13-15,22H,6-7,9-12H2,(H2,19,20,23)/t13-,15+/m0/s1 |
| InChIKey | VVGYLVDJMDNKFA-DZGCQCFKSA-N |
| XLogP | 1.29 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|