C17H26N4O — CID 56826840
1-(2-methylcyclopentyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 56826840) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(2-methylcyclopentyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(2-methylcyclopentyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 56826840 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-(2-methylcyclopentyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | CC1CCCC1NC(=O)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-13-5-4-6-15(13)20-17(22)19-14-8-11-21(12-9-14)16-7-2-3-10-18-16/h2-3,7,10,13-15H,4-6,8-9,11-12H2,1H3,(H2,19,20,22) |
| InChIKey | GNIUOBBQWBDDOG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |