C18H25N3O2 — CID 111696767
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-(5-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 111696767) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-(5-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-(5-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111696767 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-(5-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(N2CCC(C(=O)N[C@@H]3C=C[C@H](CO)C3)CC2)nc1 |
| InChI | InChI=1S/C18H25N3O2/c1-13-2-5-17(19-11-13)21-8-6-15(7-9-21)18(23)20-16-4-3-14(10-16)12-22/h2-5,11,14-16,22H,6-10,12H2,1H3,(H,20,23)/t14-,16+/m0/s1 |
| InChIKey | LBEHBKBWTMGSMA-GOEBONIOSA-N |
| XLogP | 1.66 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|