C16H21N7O2 — CID 166205676
N-[2-[(1-pyridin-2-ylpyrrolidin-3-yl)carbamoylamino]ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 166205676) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[2-[(1-pyridin-2-ylpyrrolidin-3-yl)carbamoylamino]ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[(1-pyridin-2-ylpyrrolidin-3-yl)carbamoylamino]ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166205676 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[2-[(1-pyridin-2-ylpyrrolidin-3-yl)carbamoylamino]ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccn[nH]1)NC1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C16H21N7O2/c24-15(13-4-7-20-22-13)18-8-9-19-16(25)21-12-5-10-23(11-12)14-3-1-2-6-17-14/h1-4,6-7,12H,5,8-11H2,(H,18,24)(H,20,22)(H2,19,21,25) |
| InChIKey | VNLZIWLGKLCBIX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|