C14H22N4OS — CID 97240988
1-(3-methylsulfanylpropyl)-3-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]urea (PubChem CID 97240988) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]urea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 97240988 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]urea |
| SMILES | CSCCCNC(=O)N[C@H]1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C14H22N4OS/c1-20-10-4-8-16-14(19)17-12-6-9-18(11-12)13-5-2-3-7-15-13/h2-3,5,7,12H,4,6,8-11H2,1H3,(H2,16,17,19)/t12-/m0/s1 |
| InChIKey | OHEBCEWEWBUQHH-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|