C14H23N3S — CID 43675357
N-(3-methylsulfanylpropyl)-1-pyridin-2-ylpiperidin-4-amine (PubChem CID 43675357) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-1-pyridin-2-ylpiperidin-4-amine.
| Compound Name | N-(3-methylsulfanylpropyl)-1-pyridin-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 43675357 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-1-pyridin-2-ylpiperidin-4-amine |
| SMILES | CSCCCNC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C14H23N3S/c1-18-12-4-9-15-13-6-10-17(11-7-13)14-5-2-3-8-16-14/h2-3,5,8,13,15H,4,6-7,9-12H2,1H3 |
| InChIKey | ABOGXWBRABSZPD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|