C35H44N10O4 — CID 11505694
N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[(3R)-3-[[(3R)-pyrrolidin-3-yl]carbamoylamino]pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 11505694) has the molecular formula C35H44N10O4 and a molecular weight of 668.80 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[(3R)-3-[[(3R)-pyrrolidin-3-yl]carbamoylamino]pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[(3R)-3-[[(3R)-pyrrolidin-3-yl]carbamoylamino]pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 11505694 |
| Molecular Formula | C35H44N10O4 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(benzhydrylamino)-2-[(3R)-3-[[(3R)-pyrrolidin-3-yl]carbamoylamino]pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NC(c4ccccc4)c4ccccc4)nc(N4CC[C@@H](NC(=O)N[C@@H]5CCNC5)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H44N10O4/c1-2-27(46)40-25-17-26(31(48)30(25)47)45-20-37-29-32(41-28(21-9-5-3-6-10-21)22-11-7-4-8-12-22)42-34(43-33(29)45)44-16-14-24(19-44)39-35(49)38-23-13-15-36-18-23/h3-12,20,23-26,28,30-31,36,47-48H,2,13-19H2,1H3,(H,40,46)(H2,38,39,49)(H,41,42,43)/t23-,24-,25+,26-,30-,31+/m1/s1 |
| InChIKey | OJPQAROBBOVNGP-ZVVFQSQNSA-N |
| XLogP | 1.83 |
| TPSA | 181.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |