C37H43N9O4 — CID 142104388
1-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 142104388) has the molecular formula C37H43N9O4 and a molecular weight of 677.81 g/mol. Its IUPAC name is 1-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 142104388 |
| Molecular Formula | C37H43N9O4 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.34 |
| IUPAC Name | 1-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CNC(=O)NC4CCN(c5ccccn5)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C37H43N9O4/c1-2-28-32(47)33(48)36(50-28)46-23-41-31-34(39-21-27(24-11-5-3-6-12-24)25-13-7-4-8-14-25)43-29(44-35(31)46)22-40-37(49)42-26-16-19-45(20-17-26)30-15-9-10-18-38-30/h3-15,18,23,26-28,32-33,36,47-48H,2,16-17,19-22H2,1H3,(H,39,43,44)(H2,40,42,49)/t28-,32-,33-,36-/m1/s1 |
| InChIKey | GOYRHCNYFXWQBW-REPVRFTASA-N |
| XLogP | 3.96 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |