C29H35N7O6S — CID 139947461
2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(methanesulfonamidomethyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide (PubChem CID 139947461) has the molecular formula C29H35N7O6S and a molecular weight of 609.71 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(methanesulfonamidomethyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(methanesulfonamidomethyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 139947461 |
| Molecular Formula | C29H35N7O6S |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(methanesulfonamidomethyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CNS(C)(=O)=O)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H35N7O6S/c1-3-30-23(37)14-21-25(38)26(39)29(42-21)36-17-32-24-27(34-22(35-28(24)36)16-33-43(2,40)41)31-15-20(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,20-21,25-26,29,33,38-39H,3,14-16H2,1-2H3,(H,30,37)(H,31,34,35)/t21-,25+,26+,29+/m0/s1 |
| InChIKey | GHMADQZMURJODL-PVKKLEMRSA-N |
| XLogP | 1.26 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |