C33H36N6O6S — CID 59975316
N-benzyl-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methanesulfonamide (PubChem CID 59975316) has the molecular formula C33H36N6O6S and a molecular weight of 644.75 g/mol. Its IUPAC name is N-benzyl-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methanesulfonamide.
| Compound Name | N-benzyl-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 59975316 |
| Molecular Formula | C33H36N6O6S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | N-benzyl-1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methanesulfonamide |
| SMILES | COC[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CS(=O)(=O)NCc4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H36N6O6S/c1-44-19-26-29(40)30(41)33(45-26)39-21-35-28-31(34-18-25(23-13-7-3-8-14-23)24-15-9-4-10-16-24)37-27(38-32(28)39)20-46(42,43)36-17-22-11-5-2-6-12-22/h2-16,21,25-26,29-30,33,36,40-41H,17-20H2,1H3,(H,34,37,38)/t26-,29-,30-,33-/m1/s1 |
| InChIKey | MUYKXAOUCIPCST-FTBITJBVSA-N |
| XLogP | 2.96 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |