C32H41N7O6S — CID 139947458
2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(2-methylpropylsulfonylamino)methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide (PubChem CID 139947458) has the molecular formula C32H41N7O6S and a molecular weight of 651.79 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(2-methylpropylsulfonylamino)methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(2-methylpropylsulfonylamino)methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 139947458 |
| Molecular Formula | C32H41N7O6S |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.28 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[(2-methylpropylsulfonylamino)methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CNS(=O)(=O)CC(C)C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H41N7O6S/c1-4-33-26(40)15-24-28(41)29(42)32(45-24)39-19-35-27-30(37-25(38-31(27)39)17-36-46(43,44)18-20(2)3)34-16-23(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,19-20,23-24,28-29,32,36,41-42H,4,15-18H2,1-3H3,(H,33,40)(H,34,37,38)/t24-,28+,29+,32+/m0/s1 |
| InChIKey | XWLVTJAUPUIQTE-WLMDZFNHSA-N |
| XLogP | 2.29 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |