C40H41N7O6S — CID 139947456
2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[(4-phenylphenyl)sulfonylamino]methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide (PubChem CID 139947456) has the molecular formula C40H41N7O6S and a molecular weight of 747.88 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[(4-phenylphenyl)sulfonylamino]methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[(4-phenylphenyl)sulfonylamino]methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 139947456 |
| Molecular Formula | C40H41N7O6S |
| Molecular Weight | 747.88 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-[[(4-phenylphenyl)sulfonylamino]methyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CNS(=O)(=O)c4ccc(-c5ccccc5)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C40H41N7O6S/c1-2-41-34(48)22-32-36(49)37(50)40(53-32)47-25-43-35-38(42-23-31(28-14-8-4-9-15-28)29-16-10-5-11-17-29)45-33(46-39(35)47)24-44-54(51,52)30-20-18-27(19-21-30)26-12-6-3-7-13-26/h3-21,25,31-32,36-37,40,44,49-50H,2,22-24H2,1H3,(H,41,48)(H,42,45,46)/t32-,36+,37+,40+/m0/s1 |
| InChIKey | KMULWJHTLDITFO-RUUIWEBLSA-N |
| XLogP | 4.36 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |