C34H44N8O5 — CID 20816812
5-[6-(2,2-diphenylethylamino)-2-[(4-methylpentylcarbamoylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 20816812) has the molecular formula C34H44N8O5 and a molecular weight of 644.78 g/mol. Its IUPAC name is 5-[6-(2,2-diphenylethylamino)-2-[(4-methylpentylcarbamoylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | 5-[6-(2,2-diphenylethylamino)-2-[(4-methylpentylcarbamoylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 20816812 |
| Molecular Formula | C34H44N8O5 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 5-[6-(2,2-diphenylethylamino)-2-[(4-methylpentylcarbamoylamino)methyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)C1OC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(CNC(=O)NCCCC(C)C)nc32)C(O)C1O |
| InChI | InChI=1S/C34H44N8O5/c1-4-35-32(45)29-27(43)28(44)33(47-29)42-20-39-26-30(37-18-24(22-13-7-5-8-14-22)23-15-9-6-10-16-23)40-25(41-31(26)42)19-38-34(46)36-17-11-12-21(2)3/h5-10,13-16,20-21,24,27-29,33,43-44H,4,11-12,17-19H2,1-3H3,(H,35,45)(H2,36,38,46)(H,37,40,41) |
| InChIKey | UNWHDUSXMUIRTQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 175.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|