C33H42N8O5 — CID 10211404
6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(propan-2-ylamino)propyl]purine-2-carboxamide (PubChem CID 10211404) has the molecular formula C33H42N8O5 and a molecular weight of 630.75 g/mol. Its IUPAC name is 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(propan-2-ylamino)propyl]purine-2-carboxamide.
| Compound Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(propan-2-ylamino)propyl]purine-2-carboxamide |
|---|---|
| PubChem CID | 10211404 |
| Molecular Formula | C33H42N8O5 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(propan-2-ylamino)propyl]purine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCCNC(C)C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H42N8O5/c1-4-34-31(44)27-25(42)26(43)33(46-27)41-19-38-24-28(39-29(40-30(24)41)32(45)36-17-11-16-35-20(2)3)37-18-23(21-12-7-5-8-13-21)22-14-9-6-10-15-22/h5-10,12-15,19-20,23,25-27,33,35,42-43H,4,11,16-18H2,1-3H3,(H,34,44)(H,36,45)(H,37,39,40)/t25-,26+,27-,33+/m0/s1 |
| InChIKey | UXQNOIHCPQBXSW-LIHQSLCGSA-N |
| XLogP | 1.94 |
| TPSA | 175.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|