C41H57N9O6 — CID 58655298
N-[2-(3-butylheptylcarbamoylamino)ethyl]-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide (PubChem CID 58655298) has the molecular formula C41H57N9O6 and a molecular weight of 771.96 g/mol. Its IUPAC name is N-[2-(3-butylheptylcarbamoylamino)ethyl]-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide.
| Compound Name | N-[2-(3-butylheptylcarbamoylamino)ethyl]-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide |
|---|---|
| PubChem CID | 58655298 |
| Molecular Formula | C41H57N9O6 |
| Molecular Weight | 771.96 g/mol |
| Exact Mass | 771.44 |
| IUPAC Name | N-[2-(3-butylheptylcarbamoylamino)ethyl]-6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carboxamide |
| SMILES | CCCCC(CCCC)CCNC(=O)NCCNC(=O)c1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@H](C(=O)NCC)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C41H57N9O6/c1-4-7-15-27(16-8-5-2)21-22-44-41(55)45-24-23-43-39(54)36-48-35(46-25-30(28-17-11-9-12-18-28)29-19-13-10-14-20-29)31-37(49-36)50(26-47-31)40-33(52)32(51)34(56-40)38(53)42-6-3/h9-14,17-20,26-27,30,32-34,40,51-52H,4-8,15-16,21-25H2,1-3H3,(H,42,53)(H,43,54)(H2,44,45,55)(H,46,48,49)/t32-,33+,34-,40+/m0/s1 |
| InChIKey | LQNIDHGTSWKTTF-GTNDRLPTSA-N |
| XLogP | 4.24 |
| TPSA | 204.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|