C35H39N9O5 — CID 10122494
6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(pyridin-2-ylamino)propyl]purine-2-carboxamide (PubChem CID 10122494) has the molecular formula C35H39N9O5 and a molecular weight of 665.76 g/mol. Its IUPAC name is 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(pyridin-2-ylamino)propyl]purine-2-carboxamide.
| Compound Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(pyridin-2-ylamino)propyl]purine-2-carboxamide |
|---|---|
| PubChem CID | 10122494 |
| Molecular Formula | C35H39N9O5 |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[3-(pyridin-2-ylamino)propyl]purine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCCNc4ccccn4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H39N9O5/c1-2-36-33(47)29-27(45)28(46)35(49-29)44-21-41-26-30(40-20-24(22-12-5-3-6-13-22)23-14-7-4-8-15-23)42-31(43-32(26)44)34(48)39-19-11-18-38-25-16-9-10-17-37-25/h3-10,12-17,21,24,27-29,35,45-46H,2,11,18-20H2,1H3,(H,36,47)(H,37,38)(H,39,48)(H,40,42,43)/t27-,28+,29-,35+/m0/s1 |
| InChIKey | NZLDCINKSRAJSR-LQHHRKQYSA-N |
| XLogP | 2.45 |
| TPSA | 188.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|