C36H48AsN8O5 — CID 87932722
CID 87932722 (PubChem CID 87932722) has the molecular formula C36H48AsN8O5 and a molecular weight of 747.75 g/mol.
| Compound Name | CID 87932722 |
|---|---|
| PubChem CID | 87932722 |
| Molecular Formula | C36H48AsN8O5 |
| Molecular Weight | 747.75 g/mol |
| Exact Mass | 747.30 |
| IUPAC Name | — |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C[As]C(=O)NCCN(C(C)C)C(C)C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C36H48AsN8O5/c1-6-38-34(48)31-29(46)30(47)35(50-31)45-21-41-28-32(40-20-26(24-13-9-7-10-14-24)25-15-11-8-12-16-25)42-27(43-33(28)45)19-37-36(49)39-17-18-44(22(2)3)23(4)5/h7-16,21-23,26,29-31,35,46-47H,6,17-20H2,1-5H3,(H,38,48)(H,39,49)(H,40,42,43)/t29-,30+,31-,35+/m0/s1 |
| InChIKey | USTCCQZLKPYDDU-XYIJYTLJSA-N |
| XLogP | 2.86 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.75 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|