C32H39N9O5S — CID 10168599
N-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(1-ethyl-1,2,4-triazol-3-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-2-methylpropane-1-sulfonamide (PubChem CID 10168599) has the molecular formula C32H39N9O5S and a molecular weight of 661.79 g/mol. Its IUPAC name is N-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(1-ethyl-1,2,4-triazol-3-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-2-methylpropane-1-sulfonamide.
| Compound Name | N-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(1-ethyl-1,2,4-triazol-3-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 10168599 |
| Molecular Formula | C32H39N9O5S |
| Molecular Weight | 661.79 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | N-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5R)-5-(1-ethyl-1,2,4-triazol-3-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]-2-methylpropane-1-sulfonamide |
| SMILES | CCn1cnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(CNS(=O)(=O)CC(C)C)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C32H39N9O5S/c1-4-40-18-35-30(39-40)28-26(42)27(43)32(46-28)41-19-34-25-29(37-24(38-31(25)41)16-36-47(44,45)17-20(2)3)33-15-23(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,18-20,23,26-28,32,36,42-43H,4,15-17H2,1-3H3,(H,33,37,38)/t26-,27+,28-,32+/m0/s1 |
| InChIKey | YFIMFYDUQJDUJQ-CKXMCULTSA-N |
| XLogP | 2.75 |
| TPSA | 182.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |