C35H47N7O6S — CID 10190225
2-[cyclopentyl(propan-2-yl)amino]-N-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]ethanesulfonamide (PubChem CID 10190225) has the molecular formula C35H47N7O6S and a molecular weight of 693.87 g/mol. Its IUPAC name is 2-[cyclopentyl(propan-2-yl)amino]-N-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]ethanesulfonamide.
| Compound Name | 2-[cyclopentyl(propan-2-yl)amino]-N-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 10190225 |
| Molecular Formula | C35H47N7O6S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | 2-[cyclopentyl(propan-2-yl)amino]-N-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]ethanesulfonamide |
| SMILES | CC(C)N(CCS(=O)(=O)NCc1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1)C1CCCC1 |
| InChI | InChI=1S/C35H47N7O6S/c1-23(2)41(26-15-9-10-16-26)17-18-49(46,47)38-20-29-39-33(36-19-27(24-11-5-3-6-12-24)25-13-7-4-8-14-25)30-34(40-29)42(22-37-30)35-32(45)31(44)28(21-43)48-35/h3-8,11-14,22-23,26-28,31-32,35,38,43-45H,9-10,15-21H2,1-2H3,(H,36,39,40)/t28-,31-,32-,35-/m1/s1 |
| InChIKey | BWNRPFNLXWICHN-CQFMLMEWSA-N |
| XLogP | 2.75 |
| TPSA | 174.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |