C37H42N8O5 — CID 69430839
1-(1-benzylpyrrolidin-2-yl)-3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]urea (PubChem CID 69430839) has the molecular formula C37H42N8O5 and a molecular weight of 678.79 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-2-yl)-3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]urea.
| Compound Name | 1-(1-benzylpyrrolidin-2-yl)-3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 69430839 |
| Molecular Formula | C37H42N8O5 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | 1-(1-benzylpyrrolidin-2-yl)-3-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]urea |
| SMILES | O=C(NCc1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1)NC1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C37H42N8O5/c46-22-28-32(47)33(48)36(50-28)45-23-40-31-34(38-19-27(25-13-6-2-7-14-25)26-15-8-3-9-16-26)41-29(42-35(31)45)20-39-37(49)43-30-17-10-18-44(30)21-24-11-4-1-5-12-24/h1-9,11-16,23,27-28,30,32-33,36,46-48H,10,17-22H2,(H,38,41,42)(H2,39,43,49)/t28-,30?,32-,33-,36-/m1/s1 |
| InChIKey | QITGHGQIBRMHLE-GIHMIGDHSA-N |
| XLogP | 3.10 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |