C27H31N7O4S — CID 70186998
[9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl carbamimidothioate (PubChem CID 70186998) has the molecular formula C27H31N7O4S and a molecular weight of 549.66 g/mol. Its IUPAC name is [9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl carbamimidothioate.
| Compound Name | [9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 70186998 |
| Molecular Formula | C27H31N7O4S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | [9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@H](COC)[C@@H](O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C27H31N7O4S/c1-37-13-19-22(35)23(36)26(38-19)34-15-31-21-24(32-20(33-25(21)34)14-39-27(28)29)30-12-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,15,18-19,22-23,26,35-36H,12-14H2,1H3,(H3,28,29)(H,30,32,33)/t19-,22-,23+,26-/m1/s1 |
| InChIKey | SKSANYKUZDPLEA-BLZYYQICSA-N |
| XLogP | 2.46 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|