C32H34N6O6 — CID 46874163
(3R,4S,5R)-2-[2-anilino-6-[[2-(3,5-dimethoxyphenyl)-2-phenylethyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46874163) has the molecular formula C32H34N6O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is (3R,4S,5R)-2-[2-anilino-6-[[2-(3,5-dimethoxyphenyl)-2-phenylethyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[2-anilino-6-[[2-(3,5-dimethoxyphenyl)-2-phenylethyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46874163 |
| Molecular Formula | C32H34N6O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | (3R,4S,5R)-2-[2-anilino-6-[[2-(3,5-dimethoxyphenyl)-2-phenylethyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1cc(OC)cc(C(CNc2nc(Nc3ccccc3)nc3c2ncn3C2O[C@H](CO)[C@@H](O)[C@H]2O)c2ccccc2)c1 |
| InChI | InChI=1S/C32H34N6O6/c1-42-22-13-20(14-23(15-22)43-2)24(19-9-5-3-6-10-19)16-33-29-26-30(37-32(36-29)35-21-11-7-4-8-12-21)38(18-34-26)31-28(41)27(40)25(17-39)44-31/h3-15,18,24-25,27-28,31,39-41H,16-17H2,1-2H3,(H2,33,35,36,37)/t24?,25-,27-,28-,31?/m1/s1 |
| InChIKey | BPNMKPHMQGZYIM-WRCJCCOTSA-N |
| XLogP | 3.44 |
| TPSA | 156.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |