C30H34ClN7O7 — CID 87240157
benzyl N-[(2S)-1-[[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 87240157) has the molecular formula C30H34ClN7O7 and a molecular weight of 640.10 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87240157 |
| Molecular Formula | C30H34ClN7O7 |
| Molecular Weight | 640.10 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | benzyl N-[(2S)-1-[[(1S,2R,3S,4R)-4-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CO)C(=O)N[C@H]1C[C@@H](n2cnc3c(N[C@H](CO)Cc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C30H34ClN7O7/c31-29-36-26(33-19(13-39)11-17-7-3-1-4-8-17)23-27(37-29)38(16-32-23)22-12-20(24(41)25(22)42)34-28(43)21(14-40)35-30(44)45-15-18-9-5-2-6-10-18/h1-10,16,19-22,24-25,39-42H,11-15H2,(H,34,43)(H,35,44)(H,33,36,37)/t19-,20-,21-,22+,24+,25-/m0/s1 |
| InChIKey | DMOQADFUASZVAR-QDBPOVDSSA-N |
| XLogP | 0.93 |
| TPSA | 203.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.10 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |