C23H26ClN7O4 — CID 59496968
(1R,2S,3R,5R)-3-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-[4-(hydroxymethyl)-2H-imidazol-2-yl]cyclopentane-1,2-diol (PubChem CID 59496968) has the molecular formula C23H26ClN7O4 and a molecular weight of 499.96 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-[4-(hydroxymethyl)-2H-imidazol-2-yl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-[4-(hydroxymethyl)-2H-imidazol-2-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 59496968 |
| Molecular Formula | C23H26ClN7O4 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (1R,2S,3R,5R)-3-[2-chloro-6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-[4-(hydroxymethyl)-2H-imidazol-2-yl]cyclopentane-1,2-diol |
| SMILES | OCC1=NC([C@H]2C[C@@H](n3cnc4c(N[C@H](CO)Cc5ccccc5)nc(Cl)nc43)[C@H](O)[C@@H]2O)N=C1 |
| InChI | InChI=1S/C23H26ClN7O4/c24-23-29-21(27-13(9-32)6-12-4-2-1-3-5-12)17-22(30-23)31(11-26-17)16-7-15(18(34)19(16)35)20-25-8-14(10-33)28-20/h1-5,8,11,13,15-16,18-20,32-35H,6-7,9-10H2,(H,27,29,30)/t13-,15-,16+,18+,19-,20?/m0/s1 |
| InChIKey | CQMGZGZKZRZVOQ-SIXHDRIMSA-N |
| XLogP | 0.62 |
| TPSA | 161.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |