C29H42N8O4 — CID 68915834
N-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(2-piperidin-1-ylethylamino)purin-9-yl]cyclopentyl]propanamide (PubChem CID 68915834) has the molecular formula C29H42N8O4 and a molecular weight of 566.71 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(2-piperidin-1-ylethylamino)purin-9-yl]cyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(2-piperidin-1-ylethylamino)purin-9-yl]cyclopentyl]propanamide |
|---|---|
| PubChem CID | 68915834 |
| Molecular Formula | C29H42N8O4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | N-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-(2-piperidin-1-ylethylamino)purin-9-yl]cyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(N[C@H](CO)Cc4ccccc4)nc(NCCN4CCCCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H42N8O4/c1-2-23(39)33-21-16-22(26(41)25(21)40)37-18-31-24-27(32-20(17-38)15-19-9-5-3-6-10-19)34-29(35-28(24)37)30-11-14-36-12-7-4-8-13-36/h3,5-6,9-10,18,20-22,25-26,38,40-41H,2,4,7-8,11-17H2,1H3,(H,33,39)(H2,30,32,34,35)/t20-,21-,22+,25+,26-/m0/s1 |
| InChIKey | NYTRMZMSOHMKEX-LNGSMSGUSA-N |
| XLogP | 1.30 |
| TPSA | 160.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |